food additives permitted in the EU
food additives permitted in the EU >
Colours | |
---|---|
Yellow and orange colours | |
E-100 | Curcumin |
E-101 | (i) Riboflavin, (ii) Riboflavin‐5′‐phosphate (vitamin B2) |
E-102 | Tartrazine (=FD&C Yellow no 6) |
E-104 | Quinoline yellow |
E-110 | Sunset Yellow FCF; Orange Yellow S (=FD&C Yellow no 6) |
Red colours | |
E-120 | Cochineal; Carminic acid; Carmines |
E-122 | Azorubine; Carmoisine |
E-123 | Amaranth |
E-124 | Ponceau 4R; Cochineal Red A |
E-127 | Erythrosine (=FD&C Red no 3) |
E-128 | Red 2G |
E-129 | Allura Red AC (=FD&C Red no 40) |
Blue colours | |
E-131 | Patent Blue V |
E-132 | lndigotine; Indigo Carmine (=FD&C Blue no 2) |
E-133 | Brilliant Blue FCF (=FD&C Blue no 1) |
Green colours | |
E-140 | Chlorophylls and chlorophyllins (the natural green colour of leaves) |
E-141 | Copper complexes of chlorophyll and chlorophyllins |
E-142 | Green S |
Brown and black colours | |
E-150 | a Plain caramel |
E-150 | b Caustic sulphite caramel |
E-150 | c Ammonia caramel |
E-150 | d Sulphite ammonia caramel |
E-151 | Brilliant Black BN; Black PN |
E-153 | Vegetable carbon |
E-154 | Brown FK |
E-155 | Brown HT |
Derivatives of carotene | |
E-160 | a Carotenes |
E-160 | b Annatto; Bixin; Norbixin |
E-160 | c Paprika extract; Capsanthian; Capsorubin |
E-160 | d Lycopene |
E-160 | e Beta‐apo‐8′‐carotenal (C30) |
E-160 | f Ethyl ester of beta‐apo‐8′‐carotenoic acid (C30) |
Other plant colours | |
E-161 | b Lutein |
E-161 | g Canthaxanthin |
E-162 | Beetroot Red; Betanin |
E-163 | Anthocyanins |
Inorganic compounds used as colours | |
E-170 | Calcium carbonate |
E-171 | Titanium dioxide |
E-172 | Iron oxides and hydroxides |
E-173 | Aluminium |
E-174 | Silver |
E-175 | Gold |
E-180 | Litholrubine BK |
Preservatives | |
Sorbic acid and its salts | |
E-200 | Sorbic acid |
E-202 | Potassium sorbate |
E-203 | Calcium sorbate |
Benzoic acid and its salts | |
E-210 | Benzoic acid |
E-211 | Sodium benzoate |
E-212 | Potassium benzoate |
E-213 | Calcium benzoate |
E-214 | Ethyl p‐hydroxybenzoate |
E-215 | Sodium ethyl p‐hydroxybenzoate |
E-216 | Propyl p‐hydroxybenzoate |
E-217 | Sodium propyl p‐hydroxybenzoate |
E-218 | Methyl p‐hydroxybenzoate |
E-219 | Sodium methyl p‐hydroxybenzoate |
Sulphur dioxide and its salts | |
E-220 | Sulphur dioxide |
E-221 | Sodium sulphite |
E-222 | Sodium hydrogen sulphite |
E-223 | Sodium metabisulphite |
E-224 | Potassium metabisulphite |
E-226 | Calcium sulphite |
E-227 | Calcium hydrogen sulphite |
E-228 | Potassium hydrogen sulphite |
Biphenyl and its derivatives | |
E-230 | Biphenyl; diphenyl (for surface treatment of citrus fruits) |
E-231 | Orthophenyl phenol (for surface treatment of citrus fruits) |
E-232 | Sodium orthophenyl phenol (sodium biphenyl‐2‐yl oxide) |
Other preservatives | |
E-234 | Nisin |
E-235 | Natamycin (NATA, for surface treatment of cheeses and dried cured sausages) |
E-239 | Hexamethylene tetramine (hexamine) |
E-242 | Dimethyl dicarbonate |
E-110 | 5 Lysozyme (an antibacterial enzyme found in tears) |
Pickling salts | |
E-249 | Potassium nitrite |
E-250 | Sodium nitrite |
E-251 | Sodium nitrate |
E-252 | Potassium nitrate (saltpetre) |
Acids and their salts | |
E-280 | |
E-281 | Sodium propionate |
E-282 | Calcium propionate |
E-283 | Potassium propionate |
E-284 | Boric acid |
E-285 | Sodium tetraborate; borax |
Antioxidants | |
E-300 | Ascorbic acid |
E-301 | Sodium ascorbate |
E-302 | Calcium ascorbate |
E-304 | Fatty acid esters of ascorbic acid (a lipid‐soluble derivative of the vitamin) |
E-306 | Tocopherols (natural source, mixed isomers) |
E-307 | Alpha‐tocopherol |
E-308 | Gamma‐tocopherol |
E-309 | Delta‐tocopherol |
Other antioxidants | |
E-310 | Propyl gallate |
E-311 | Octyl gallate |
E-312 | Dodecyl gallate |
E-315 | Erythorbic acid (the d‐isomer of vitamin C, little vitamin activity) |
E-316 | Sodium erythorbate |
E-320 | Butylated hydroxyanisole (BHA) |
E-321 | Butylated hydroxytoluene (BHT) |
Sweeteners | |
(Sugar alcohols used as bulk sweeteners) | |
E-420 | (i) Sorbitol, (ii) Sorbitol syrup |
E-421 | Mannitol |
E-953 | lsomalt |
E-965 | (i) Maltitol, (ii) Maltitol syrup |
E-966 | Lactitol |
E-967 | Xylitol |
Intense (synthetic) sweeteners | |
E-950 | Acesulfame K |
E-951 | Aspartame |
E-952 | Cyclamic acid and its Na and Ca salts |
E-954 | Saccharin and its Na, K and Ca salts |
E-957 | Thaumatin |
E-959 | Neohesperidine DC |
Emulsifiers, Stabilizers, Thickeners and Gelling Agents | |
E-322 | Lecithins (found especially in egg yolk and soya bean) |
Alginates | |
E-400 | Alginic acid |
E-401 | Sodium alginate |
E-402 | Potassium alginate |
E-403 | Ammonium alginate |
E-404 | Calcium alginate |
E-405 | Propane‐1,2‐diol alginate |
Plant gums (soluble fibre) | |
E-406 | Agar |
E-407 | Carrageenan |
E-407 | a Processed eucheuma seaweed |
E-410 | Locust bean gum; carob gum |
E-412 | |
E-413 | Tragacanth |
E-414 | Acacia gum; gum arabic |
E-415 | Xanthan gum |
E-416 | Karaya gum |
E-417 | Tara gum |
E-418 | Gellan gum |
E-425 | Konjac |
Polysorbates | |
E-432 | Polyoxyethylene sorbitan monolaurate; Polysorbate 20 |
E-433 | Polyoxyethylene sorbitan mono‐oleate; Polysorbate 80 |
E-434 | Polyoxyethylene sorbitan monopalmitate; Polysorbate 40 |
E-435 | Polyoxyethylene sorbitan monostearate; Polysorbate 60 |
E-436 | Polyoxyethylene sorbitan tristearate; Polysorbate 65 |
Cellulose derivatives | |
E-460 | Cellulose |
E-461 | |
E-463 | Hydroxypropyl cellulose |
E-464 | Hydroxypropyl methyl cellulose |
E-465 | Ethylmethyl cellulose |
E-466 | Carboxymethylcellulose, Sodium carboxymethylcellulose |
E-468 | Crosslinked sodium carboxymethylcellulose |
E-469 | Enzymatically hydrolysed carboxymethylcellulose |
Fatty acid derivatives and modified fats | |
E-470 | a Sodium, potassium and calcium salts of fatty acids |
E-470 | b Magnesium salts of fatty acids |
E-471 | Mono‐ and diglycerides of fatty acids |
E-472 | a Acetic acid esters of mono‐ and diglycerides of fatty acids |
E-472 | b Lactic acid esters of mono‐ and diglycerides of fatty acids |
E-472 | c Citric acid esters of mono‐ and diglycerides of fatty acids |
E-472 | d Tartaric acid esters of mono‐ and diglycerides of fatty acids |
E-472 | e Mono‐ and diacetyl tartaric acid esters of mono‐ and diglycerides of fatty acids |
E-472 | f Mixed acetic and tartaric acid esters of mono‐ and diglycerides of fatty acids |
E-473 | Sucrose esters of fatty acids |
E-474 | Sucroglycerides |
E-475 | Polyglycerol esters of fatty acids |
E-476 | Polyglycerol polyricinoleate |
E-477 | Propane‐1,2‐diol esters of fatty acids |
E-479 | b Thermally oxidised soya bean oil interacted with mono and diglycerides of fatty acids |
E-481 | Sodium stearoyl‐2‐lactylate |
E-482 | Calcium stearoyl‐2‐lactylate |
E-483 | Stearyl tartrate |
E-491 | Sorbitan monostearate |
E-492 | Sorbitan tristearate |
E-493 | Sorbitan monolaurate |
E-494 | Sorbitan mono‐oleate |
E-495 | Sorbitan monopalmitate |
Other compounds | |
E-440 | Pectins (found naturally in fruit, especially apples) |
E-442 | Ammonium phosphatides |
E-444 | Sucrose acetate isobutyrate |
E-445 | Glycerol esters of wood rosins |
E-110 | 3 Invertase |
Other additives | |
Acid, acidity regulators, anti‐caking agents, anti‐foaming agents, bulking agents, carriers and carrier solvents, emulsifying salts, firming agents, flavour enhancers, flour treatment agents, foaming agents, glazing agents, humectants, modified starches, packaging gases, propellants, raising agents and sequestrants. | |
Acidity regulators | |
Carbon dioxide and carbonates | |
E-170 | Calcium carbonates |
E-290 | Carbon dioxide |
E-500 | Sodium carbonates |
E-501 | Potassium carbonates |
E-503 | Ammonium carbonates |
E-504 | Magnesium carbonates |
Acetic acid and its salts | |
E-260 | Acetic acid (vinegar is dilute acetic acid) |
E-261 | Potassium acetate |
E-262 | Sodium acetate |
E-263 | Calcium acetate |
Lactic acid and its salts | |
E-270 | Lactic acid (the acid of sour milk) |
E-325 | Sodium lactate |
E-326 | Potassium lactate |
E-327 | Calcium lactate |
Citric acid and its salts | |
E-330 | Citric acid |
E-331 | Sodium citrates |
E-332 | Potassium citrates |
E-333 | Calcium citrates |
E-380 | Triammonium citrate |
Tartaric acid and its salts | |
E-334 | Tartaric acid (l‐(+)) |
E-335 | Sodium tartrates |
E-336 | Potassium tartrates (cream of tartar) |
E-337 | Sodium potassium tartrate |
E-353 | Metatartaric acid |
E-354 | Calcium tartrate |
Phosphoric acid and its salts | |
E-338 | Phosphoric acid |
E-339 | Sodium phosphates |
E-340 | Potassium phosphates |
E-341 | Calcium phosphates |
E-343 | Magnesium phosphates |
E-450 | Diphosphates |
E-451 | Triphosphates |
E-452 | Polyphosphates |
E-541 | Sodium aluminium phosphate |
Malic acid and its salts | |
E-296 | |
E-350 | Sodium malates |
E-351 | Potassium malate |
E-352 | Calcium malates |
Adipic acid and its salts | |
E-355 | Adipic acid |
E-356 | Sodium adipate |
E-357 | Potassium adipate |
Hydrochloric acid and its salts | |
E-507 | |
E-508 | Potassium chloride |
E-509 | Calcium chloride |
E-511 | Magnesium chloride |
E-512 | Stannous chloride |
Sulphuric acid and its salts | |
E-513 | Sulphuric acid |
E-514 | Sodium sulphates |
E-515 | Potassium sulphates |
E-516 | Calcium sulphate |
E-517 | Ammonium sulphate |
E-520 | Aluminium sulphate |
E-521 | Aluminium sodium sulphate |
E-522 | Aluminium potassium sulphate |
E-523 | Aluminium ammonium sulphate |
Other acids and their salts | |
E-297 | Fumaric acid |
E-363 | Succinic acid |
E-385 | Calcium disodium ethylene diamine tetra‐acetate; calcium disodium EDTA |
Alkalis | |
E-524 | Sodium hydroxide |
E-525 | Potassium hydroxide |
E-526 | Calcium hydroxide |
E-527 | Ammonium hydroxide |
E-528 | Magnesium hydroxide |
E-529 | Calcium oxide |
E-530 | Magnesium oxide |
Other salts | |
E-535 | Sodium ferrocyanide |
E-536 | Potassium ferrocyanide |
E-538 | Calcium ferrocyanide |
Compounds used as anti‐caking agents and other uses | |
E-422 | Glycerol (used as a humectant, also for its sweetness) |
E-431 | Polyoxyethylene (40) stearate |
E-459 | Beta‐cyclodextrin |
Silicon salts | |
E-551 | Silicon dioxide |
E 552 Calcium silicate | |
E-553 | a (i) Magnesium silicate, (ii) Magnesium trisilicate |
E-553 | b Talc |
E-554 | Sodium aluminium silicate |
E-555 | Potassium aluminium silicate |
E-556 | Aluminium calcium silicate |
Other compounds | |
E-558 | Bentonite |
E-559 | Aluminium silicate; Kaolin |
E-570 | |
E-574 | Gluconic acid |
E-575 | Glucono delta‐lactone |
E-576 | Sodium gluconate |
E-577 | Potassium gluconate |
E-578 | Calcium gluconate |
E-579 | Ferrous gluconate |
E-585 | Ferrous lactate |
Compounds used as flavour enhancers | |
Amino acids | |
E-620 | Glutamic acid |
E-621 | |
E-622 | Monopotassium glutamate |
E-623 | Calcium diglutamate |
E-624 | Monoammonium glutamate |
E-625 | Magnesium diglutamate |
E-640 | Glycine and its sodium salt |
Nucleotides | |
E-626 | Guanylic acid |
E-627 | Disodium guanylate |
E-628 | Dipotassium guanylate |
E-629 | Calcium guanylate |
E-630 | lnosinic acid |
E-631 | Disodium inosinate |
E-632 | Dipotassium inosinate |
E-633 | Calcium inosinate |
E-634 | Calcium 5′‐ribonucleotides |
E-635 | Disodium 5′‐ribonucleotides |
Other compounds | |
E-650 | Zinc acetate |
Compounds used as glazing agents | |
E-900 | Dimethylpolysiloxane |
E-901 | Beeswax, white and yellow |
E-902 | Candelilla wax |
E-903 | Carnauba wax |
E-904 | Shellac |
E-905 | Microcrystalline wax |
E-912 | Montan acid esters (for surface treatment of citrus fruits) |
E-914 | Oxidised Polyethylene wax |
Compounds used to treat flour | |
E-920 | l‐Cysteine (an amino acid) |
E-927 | b Carbamide |
Propellant gases | |
E-938 | Argon |
E-939 | Helium |
E-941 | Nitrogen |
E-942 | Nitrous oxide |
E-943 | a Butane |
E-943 | b Iso‐butane |
E-944 | Propane |
E-948 | Oxygen |
E-949 | Hydrogen |
Modified starches (used as thickening and gelling agents) | |
E-140 | 4 Oxidised starch |
E-141 | 0 Monostarch phosphate |
E-141 | 2 Distarch phosphate |
E-141 | 3 Phosphated distarch phosphate |
E-141 | 4 Acetylated distarch phosphate |
E-142 | 0 Acetylated starch |
E-142 | 2 Acetylated distarch adipate |
E-144 | 0 Hydroxylpropyl starch |
E-144 | 2 Hydroxypropyl distarch phosphate |
E-145 | 0 Starch sodium octanoyl succinate |
E-145 | 1 Acetylated oxidised starch |
Miscellaneous compounds | |
E-999 | Quillaia extract |
E-120 | 0 Polydextrose |
E-120 | 1 Polyvinylpyrrolidone |
E-120 | 2 Polyvinylpolypyrrolidone |
E-150 | 5 Triethyl citrate |
E-151 | 8 Glyceryl triacetate; triacetin |
E-152 | 0 Propane‐1,2‐diol; propylene glycol |
More From encyclopedia.com
Malic acid , malic acid (2-hydroxybutanedioic acid) A crystalline solid, HOOCCH(OH)CH2COOH. L-malic acid occurs in living organisms as an intermediate metabolite… Aspartic Acid , aspartic acid (aspartate) (ă-spar-tik) n. see amino acid.
aspartic acid (aspartate) A non‐essential amino acid.
aspartic acid An aliphatic, acidic, p… Glutamic Acid , glutamic acid A non‐essential amino acid; it is acidic since it has two carboxylic acid groups; its amide is glutamine. See also monosodium glutamate… Nitric Acid , Nitric acid (HNO3) is a colorless, liquid acid widely used in the manufacturing of explosives and fertilizers. When dissolved in water, molecules of… Oleic Acid , oleic acid An unsaturated fatty acid with one double bond, CH3(CH2)7CH:CH(CH2)7COOH. Oleic acid is one of the most abundant constituent fatty acids o… Carboxylic Acid , Carboxylic acids are chemical compounds that contain a carboxyl group , which is -COOH. The carboxyl group is attached to another hydrogen atom or to…
About this article
food additives permitted in the EU
You Might Also Like
NEARBY TERMS
food additives permitted in the EU